| Name |
Imidazo[1,5-a]pyridine-1,3-dicarboxamide, N1-(4-chloro-2,5-dimethoxyphenyl)-N3-(2-ethylphenyl)-
|
| Molecular Formula |
C25H23ClN4O4
|
| Molecular Weight |
478.9
|
| Smiles |
CCc1ccccc1NC(=O)c1nc(C(=O)Nc2cc(OC)c(Cl)cc2OC)c2ccccn12
|
CCc1ccccc1NC(=O)c1nc(C(=O)Nc2cc(OC)c(Cl)cc2OC)c2ccccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.