| Name |
(2S,5R,5aS,7R,11S)-3,4,5,5a-Tetrahydro-2-(1-hydroxy-1-methylethyl)-5-methyl-7,9,11-tris(3-methyl-2-buten-1-yl)-5a-(2-methyl-1-oxopropyl)-5,7-ethano-1-benzoxepin-6,8(2H,7H)-dione
|
| Molecular Formula |
C35H52O5
|
| Molecular Weight |
552.8
|
| Smiles |
CC(C)=CCC1=C2OC(C(C)(C)O)CCC3(C)C(CC=C(C)C)CC(CC=C(C)C)(C1=O)C(=O)C23C(=O)C(C)C
|
CC(C)=CCC1=C2OC(C(C)(C)O)CCC3(C)C(CC=C(C)C)CC(CC=C(C)C)(C1=O)C(=O)C23C(=O)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.