| Name |
1,3-Dioxane-4-acetic acid, 6-[2-[4-(4-fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]ethenyl]-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R,6R)-rel-
|
| Molecular Formula |
C29H40FN3O6S
|
| Molecular Weight |
577.7
|
| Smiles |
CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1
|
CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.