| Name |
(2S)-2-{[5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,2-oxazol-3-yl]formamido}-4-hydroxybutanoic acid
|
| Molecular Formula |
C23H21N3O7
|
| Molecular Weight |
451.4
|
| Smiles |
O=C(Nc1cc(C(=O)NC(CCO)C(=O)O)no1)OCC1c2ccccc2-c2ccccc21
|
O=C(Nc1cc(C(=O)NC(CCO)C(=O)O)no1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.