| Name |
2-[3-bromo-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]acetic acid
|
| Molecular Formula |
C23H18BrNO4
|
| Molecular Weight |
452.3
|
| Smiles |
O=C(O)Cc1cccc(Br)c1NC(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)Cc1cccc(Br)c1NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.