| Name |
{3-Oxa-10-thia-4-azatricyclo[7.3.0.0,2,6]dodeca-1(9),2(6),4,11-tetraen-5-yl}methanesulfonyl chloride
|
| Molecular Formula |
C10H8ClNO3S2
|
| Molecular Weight |
289.8
|
| Smiles |
O=S(=O)(Cl)Cc1noc2c1CCc1sccc1-2
|
O=S(=O)(Cl)Cc1noc2c1CCc1sccc1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.