| Name |
1,3-Benzoxaphosphole, 4-(9-anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-, 3-oxide, (3S)-
|
| Molecular Formula |
C25H23O2P
|
| Molecular Weight |
386.4
|
| Smiles |
CC(C)(C)P1(=O)COc2cccc(-c3c4ccccc4cc4ccccc34)c21
|
CC(C)(C)P1(=O)COc2cccc(-c3c4ccccc4cc4ccccc34)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.