| Name |
1-(2,2,2-trifluoroacetyl)-1H,2H-imidazo[1,5-a]pyrimidine-3-carboxylic acid
|
| Molecular Formula |
C9H6F3N3O3
|
| Molecular Weight |
261.16
|
| Smiles |
O=C(O)C1=Cn2cncc2N(C(=O)C(F)(F)F)C1
|
O=C(O)C1=Cn2cncc2N(C(=O)C(F)(F)F)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.