| Name |
1-[(5-bromo-1,3-thiazol-2-yl)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
|
| Molecular Formula |
C9H11BrN4S
|
| Molecular Weight |
287.18
|
| Smiles |
Cc1nn(Cc2ncc(Br)s2)c(C)c1N
|
Cc1nn(Cc2ncc(Br)s2)c(C)c1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.