| Name |
3-{[1-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy}pyrrolidine
|
| Molecular Formula |
C12H17N5O
|
| Molecular Weight |
247.30
|
| Smiles |
CC(C)n1ncc2c(OC3CCNC3)ncnc21
|
CC(C)n1ncc2c(OC3CCNC3)ncnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.