| Name |
5-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 5-azaspiro[2.4]heptane-1,5-dicarboxylate
|
| Molecular Formula |
C20H22N2O6
|
| Molecular Weight |
386.4
|
| Smiles |
CC(C)(C)OC(=O)N1CCC2(CC2C(=O)ON2C(=O)c3ccccc3C2=O)C1
|
CC(C)(C)OC(=O)N1CCC2(CC2C(=O)ON2C(=O)c3ccccc3C2=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.