| Name |
2-Chloro-N1,N4-dimethyl-1,4-benzenedisulfonamide
|
| Molecular Formula |
C8H11ClN2O4S2
|
| Molecular Weight |
298.8
|
| Smiles |
CNS(=O)(=O)c1ccc(S(=O)(=O)NC)c(Cl)c1
|
CNS(=O)(=O)c1ccc(S(=O)(=O)NC)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.