| Name |
rac-2-[(2R,4aS,7aR)-4-[(benzyloxy)carbonyl]-hexahydro-2H-furo[3,4-b][1,4]oxazin-2-yl]acetic acid
|
| Molecular Formula |
C16H19NO6
|
| Molecular Weight |
321.32
|
| Smiles |
O=C(O)CC1CN(C(=O)OCc2ccccc2)C2COCC2O1
|
O=C(O)CC1CN(C(=O)OCc2ccccc2)C2COCC2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.