| Name |
tert-butyl N-{2-oxo-1-[6-(1H-1,2,4-triazol-1-yl)pyridin-3-yl]ethyl}carbamate
|
| Molecular Formula |
C14H17N5O3
|
| Molecular Weight |
303.32
|
| Smiles |
CC(C)(C)OC(=O)NC(C=O)c1ccc(-n2cncn2)nc1
|
CC(C)(C)OC(=O)NC(C=O)c1ccc(-n2cncn2)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.