| Name |
1-({5-Chlorothieno[3,2-b]pyridin-2-yl}methyl)cyclopropan-1-amine
|
| Molecular Formula |
C11H11ClN2S
|
| Molecular Weight |
238.74
|
| Smiles |
NC1(Cc2cc3nc(Cl)ccc3s2)CC1
|
NC1(Cc2cc3nc(Cl)ccc3s2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.