| Name |
(3R)-3-{5-[(dimethylamino)methyl]-1,3-thiazol-2-yl}-3-hydroxypropanoic acid
|
| Molecular Formula |
C9H14N2O3S
|
| Molecular Weight |
230.29
|
| Smiles |
CN(C)Cc1cnc(C(O)CC(=O)O)s1
|
CN(C)Cc1cnc(C(O)CC(=O)O)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.