| Name |
[5-Amino-2-methyl-3-(piperazin-1-yl)phenyl]methanesulfonyl fluoride
|
| Molecular Formula |
C12H18FN3O2S
|
| Molecular Weight |
287.36
|
| Smiles |
Cc1c(CS(=O)(=O)F)cc(N)cc1N1CCNCC1
|
Cc1c(CS(=O)(=O)F)cc(N)cc1N1CCNCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.