| Name |
5-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoyl]-4H,5H,6H,7H-thieno[3,2-c]pyridine-4-carboxylic acid
|
| Molecular Formula |
C27H26N2O5S
|
| Molecular Weight |
490.6
|
| Smiles |
O=C(NCCCC(=O)N1CCc2sccc2C1C(=O)O)OCC1c2ccccc2-c2ccccc21
|
O=C(NCCCC(=O)N1CCc2sccc2C1C(=O)O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.