| Name |
8-Benzyl-2,4-dichloro-7,8-dihydro-5H-pyrimido[4,5-c]azepin-9(6H)-one
|
| Molecular Formula |
C15H13Cl2N3O
|
| Molecular Weight |
322.2
|
| Smiles |
O=C1c2nc(Cl)nc(Cl)c2CCCN1Cc1ccccc1
|
O=C1c2nc(Cl)nc(Cl)c2CCCN1Cc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.