| Name |
Tert-butyl 4-{3-[(fluorosulfonyl)oxy]-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]phenyl}piperazine-1-carboxylate
|
| Molecular Formula |
C23H37FN4O5S
|
| Molecular Weight |
500.6
|
| Smiles |
Cc1c(CN2CCNCC2)c(C)c(N2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1OS(=O)(=O)F
|
Cc1c(CN2CCNCC2)c(C)c(N2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1OS(=O)(=O)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.