| Name |
tert-butyl N-{[4-(3-bromophenyl)-1,3-thiazol-2-yl]methyl}-N-(2-methoxyethyl)carbamate
|
| Molecular Formula |
C18H23BrN2O3S
|
| Molecular Weight |
427.4
|
| Smiles |
COCCN(Cc1nc(-c2cccc(Br)c2)cs1)C(=O)OC(C)(C)C
|
COCCN(Cc1nc(-c2cccc(Br)c2)cs1)C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.