| Name |
3-(3,5-Dichloropyridin-2-yl)-4,4-difluorobutanoic acid
|
| Molecular Formula |
C9H7Cl2F2NO2
|
| Molecular Weight |
270.06
|
| Smiles |
O=C(O)CC(c1ncc(Cl)cc1Cl)C(F)F
|
O=C(O)CC(c1ncc(Cl)cc1Cl)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.