| Name |
8H-Imidazo[2,1-c][1,4]oxazine-2-carboxylic acid, 6-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-5,6-dihydro-, ethyl ester
|
| Molecular Formula |
C15H23N3O5
|
| Molecular Weight |
325.36
|
| Smiles |
CCOC(=O)c1cn2c(n1)COC(CNC(=O)OC(C)(C)C)C2
|
CCOC(=O)c1cn2c(n1)COC(CNC(=O)OC(C)(C)C)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.