| Name |
3,5-Dimethyl-3-pentyl-1,2,3,4-tetrahydropyridine-2,4-dione
|
| Molecular Formula |
C12H19NO2
|
| Molecular Weight |
209.28
|
| Smiles |
CCCCCC1(C)C(=O)NC=C(C)C1=O
|
CCCCCC1(C)C(=O)NC=C(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.