| Name |
N-(1-{[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]methyl}piperidin-3-yl)cyclopropanecarboxamide
|
| Molecular Formula |
C17H26N4O3
|
| Molecular Weight |
334.4
|
| Smiles |
O=C(NC1CCCN(Cc2noc(C3CCOCC3)n2)C1)C1CC1
|
O=C(NC1CCCN(Cc2noc(C3CCOCC3)n2)C1)C1CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.