| Name |
2-(4,4-difluoropiperidine-1-carbonyl)-4-{7H-pyrrolo[2,3-d]pyrimidin-4-yl}morpholine
|
| Molecular Formula |
C16H19F2N5O2
|
| Molecular Weight |
351.35
|
| Smiles |
O=C(C1CN(c2ncnc3[nH]ccc23)CCO1)N1CCC(F)(F)CC1
|
O=C(C1CN(c2ncnc3[nH]ccc23)CCO1)N1CCC(F)(F)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.