| Name |
3,3-Difluoro-1-{imidazo[1,2-a]pyrazin-3-yl}cyclobutan-1-amine
|
| Molecular Formula |
C10H10F2N4
|
| Molecular Weight |
224.21
|
| Smiles |
NC1(c2cnc3cnccn23)CC(F)(F)C1
|
NC1(c2cnc3cnccn23)CC(F)(F)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.