| Name |
(S)-2-Hydroxy-N-(1,1,3,3-tetramethylbutyl)propanamide
|
| Molecular Formula |
C11H23NO2
|
| Molecular Weight |
201.31
|
| Smiles |
CC(O)C(=O)NC(C)(C)CC(C)(C)C
|
CC(O)C(=O)NC(C)(C)CC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.