| Name |
2-[(2S)-1-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-1,3-thiazole-4-carbonyl}pyrrolidin-2-yl]acetic acid
|
| Molecular Formula |
C26H25N3O5S
|
| Molecular Weight |
491.6
|
| Smiles |
O=C(O)CC1CCCN1C(=O)c1csc(CNC(=O)OCC2c3ccccc3-c3ccccc32)n1
|
O=C(O)CC1CCCN1C(=O)c1csc(CNC(=O)OCC2c3ccccc3-c3ccccc32)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.