| Name |
8-Oxa-3,5-dithia-4-phosphanonanoic acid, 4-ethoxy-7-oxo-, methyl ester, 4-oxide
|
| Molecular Formula |
C8H15O6PS2
|
| Molecular Weight |
302.3
|
| Smiles |
CCOP(=O)(SCC(=O)OC)SCC(=O)OC
|
CCOP(=O)(SCC(=O)OC)SCC(=O)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.