| Name |
5-{3-[benzyl(methyl)amino]-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido}-3-methyl-1,2-thiazole-4-carboxylic acid
|
| Molecular Formula |
C31H30N4O5S
|
| Molecular Weight |
570.7
|
| Smiles |
Cc1nsc(NC(=O)C(CN(C)Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)c1C(=O)O
|
Cc1nsc(NC(=O)C(CN(C)Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)c1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.