| Name |
3,3,9-Trimethyl-2,6,12-trioxa-9,15-diazadispiro[4.2.5^{8}.2^{5}]pentadecane
|
| Molecular Formula |
C13H24N2O3
|
| Molecular Weight |
256.34
|
| Smiles |
CN1CCOCC12CNC1(COC(C)(C)C1)OC2
|
CN1CCOCC12CNC1(COC(C)(C)C1)OC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.