| Name |
4,4'-(Cyclopent-1-ene-1,2-diylbis(5-methylthiophene-4,2-diyl))dibenzaldehyde
|
| Molecular Formula |
C29H24O2S2
|
| Molecular Weight |
468.6
|
| Smiles |
Cc1sc(-c2ccc(C=O)cc2)cc1C1=C(c2cc(-c3ccc(C=O)cc3)sc2C)CCC1
|
Cc1sc(-c2ccc(C=O)cc2)cc1C1=C(c2cc(-c3ccc(C=O)cc3)sc2C)CCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.