| Name |
Carbamic acid, (4,5-dihydro-1-methyl-1-oxido-3-oxo-3H-1I>>4-isothiazol-4-yl)-, phenylmethyl ester, (R)-
|
| Molecular Formula |
C12H14N2O4S
|
| Molecular Weight |
282.32
|
| Smiles |
CS1(=O)=NC(=O)C(NC(=O)OCc2ccccc2)C1
|
CS1(=O)=NC(=O)C(NC(=O)OCc2ccccc2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.