| Name |
1H-Pyrido[3,2-c]azepine-1-carboxylic acid, decahydro-7-oxo-, 1,1-dimethylethyl ester, (4aR,9aS)-rel-
|
| Molecular Formula |
C14H24N2O3
|
| Molecular Weight |
268.35
|
| Smiles |
CC(C)(C)OC(=O)N1CCCC2CNC(=O)CCC21
|
CC(C)(C)OC(=O)N1CCCC2CNC(=O)CCC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.