| Name |
[2-[(8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-10,13,16-trimethyl-3,11-dioxo-1,2,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate
|
| Molecular Formula |
C24H30O6
|
| Molecular Weight |
414.5
|
| Smiles |
CC(=O)OCC(=O)C1(O)C(C)CC2C3C=CC4=CC(=O)CCC4(C)C3C(=O)CC21C
|
CC(=O)OCC(=O)C1(O)C(C)CC2C3C=CC4=CC(=O)CCC4(C)C3C(=O)CC21C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.