| Name |
1-(1-Azetidinyl)-1,3-dihydro-6-methylfuro[3,4-c]pyridin-7-ol
|
| Molecular Formula |
C11H14N2O2
|
| Molecular Weight |
206.24
|
| Smiles |
Cc1ncc2c(c1O)C(N1CCC1)OC2
|
Cc1ncc2c(c1O)C(N1CCC1)OC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.