| Name |
2,6-Dihydro-3,4-dimethyl-7H-pyrazolo[3,4-d]pyridazin-7-one
|
| Molecular Formula |
C7H8N4O
|
| Molecular Weight |
164.16
|
| Smiles |
Cc1n[nH]c(=O)c2n[nH]c(C)c12
|
Cc1n[nH]c(=O)c2n[nH]c(C)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.