| Name |
[1,1a(2)-Biphenyl]-2,2a(2)-diamine, N,N,Na(2),Na(2)-tetra(methyl-d3)-
|
| Molecular Formula |
C16H20N2
|
| Molecular Weight |
252.42
|
| Smiles |
CN(C)c1ccccc1-c1ccccc1N(C)C
|
CN(C)c1ccccc1-c1ccccc1N(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.