| Name |
1,3-Piperidinedicarboxylic acid, 4-fluoro-3-methyl-, 1-(1,1-dimethylethyl) 3-ethyl ester
|
| Molecular Formula |
C14H24FNO4
|
| Molecular Weight |
289.34
|
| Smiles |
CCOC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCC1F
|
CCOC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCC1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.