| Name |
7H-Furo[2,3-f][1]benzopyran-3,7(2H)-dione, 9-(6-bromo-4H-1,3-benzodioxin-8-yl)-8,9-dihydro-2-[(4-methoxyphenyl)methylene]-
|
| Molecular Formula |
C27H19BrO7
|
| Molecular Weight |
535.3
|
| Smiles |
COc1ccc(C=C2Oc3c(ccc4c3C(c3cc(Br)cc5c3OCOC5)CC(=O)O4)C2=O)cc1
|
COc1ccc(C=C2Oc3c(ccc4c3C(c3cc(Br)cc5c3OCOC5)CC(=O)O4)C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.