| Name |
5,5a(2)-Dimethyl-3,3a(2)-dinitro-2,2a(2)-bipyridine
|
| Molecular Formula |
C12H10N4O4
|
| Molecular Weight |
274.23
|
| Smiles |
Cc1cnc(-c2ncc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1
|
Cc1cnc(-c2ncc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.