| Name |
N-[5-(2-fluorophenyl)-1-methyl-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-[1,2,3]triazolo[1,5-a]pyridine-6-carboxamide
|
| Molecular Formula |
C23H17FN6O2
|
| Molecular Weight |
428.4
|
| Smiles |
CN1C(=O)C(NC(=O)c2ccc3cnnn3c2)N=C(c2ccccc2F)c2ccccc21
|
CN1C(=O)C(NC(=O)c2ccc3cnnn3c2)N=C(c2ccccc2F)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.