| Name |
D-Glucopyranose, 2-azido-2-deoxy-3,6-bis-O-(phenylmethyl)-, 4-acetate 1-(2,2,2-trichloroethanimidate)
|
| Molecular Formula |
C24H25Cl3N4O6
|
| Molecular Weight |
571.8
|
| Smiles |
CC(=O)OC1C(COCc2ccccc2)OC(OC(=N)C(Cl)(Cl)Cl)C(N=[N+]=[N-])C1OCc1ccccc1
|
CC(=O)OC1C(COCc2ccccc2)OC(OC(=N)C(Cl)(Cl)Cl)C(N=[N+]=[N-])C1OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.