| Name |
Butanoic acid, 3,3-dimethyl-, 6,7a-dihydro-4-[(3-hydroxy-3-methyl-1-oxobutoxy)methyl]-1-(3-methyl-1-oxobutoxy)spiro[cyclopenta[c]pyran-7(1H),2a(2)-oxiran]-6-yl ester, [1S-(1I+/-,6I+/-,7I(2),7aI+/-)]-
|
| Molecular Formula |
C26H38O9
|
| Molecular Weight |
494.6
|
| Smiles |
CC(C)CC(=O)OC1OC=C(COC(=O)CC(C)(C)O)C2=CC(OC(=O)CC(C)(C)C)C3(CO3)C21
|
CC(C)CC(=O)OC1OC=C(COC(=O)CC(C)(C)O)C2=CC(OC(=O)CC(C)(C)C)C3(CO3)C21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.