| Name |
[N(E)]-N-[(3R,5aS,6R,8aS,9R,12R,12aR)-Octahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-ylidene]-I(2)-alanyl-L-histidine
|
| Molecular Formula |
C24H34N4O7
|
| Molecular Weight |
490.5
|
| Smiles |
CC1CCC2C(C)C(=NCCC(=O)NC(Cc3cnc[nH]3)C(=O)O)OC3OC4(C)CCC1C32OO4
|
CC1CCC2C(C)C(=NCCC(=O)NC(Cc3cnc[nH]3)C(=O)O)OC3OC4(C)CCC1C32OO4
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.