| Name |
2-[3-(2H-1,2,3,4-tetrazol-5-yl)-1H-1,2,4-triazol-1-yl]ethan-1-amine hydrochloride
|
| Molecular Formula |
C5H9ClN8
|
| Molecular Weight |
216.63
|
| Smiles |
Cl.NCCn1cnc(-c2nn[nH]n2)n1
|
Cl.NCCn1cnc(-c2nn[nH]n2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.