| Name |
4-{1H-pyrrolo[2,3-b]pyridin-5-yl}piperidine dihydrochloride
|
| Molecular Formula |
C12H17Cl2N3
|
| Molecular Weight |
274.19
|
| Smiles |
Cl.Cl.c1cc2cc(C3CCNCC3)cnc2[nH]1
|
Cl.Cl.c1cc2cc(C3CCNCC3)cnc2[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.