| Name |
rac-2-{N-benzyl-1-[(1R,5R,6S)-6-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)bicyclo[3.2.0]heptan-3-yl]formamido}acetic acid
|
| Molecular Formula |
C32H32N2O5
|
| Molecular Weight |
524.6
|
| Smiles |
O=C(O)CN(Cc1ccccc1)C(=O)C1CC2CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C2C1
|
O=C(O)CN(Cc1ccccc1)C(=O)C1CC2CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.