| Name |
(1R,5S,6r)-6-{[5-(trifluoromethyl)pyridin-2-yl]oxy}-3-azabicyclo[3.1.1]heptane hydrochloride
|
| Molecular Formula |
C12H14ClF3N2O
|
| Molecular Weight |
294.70
|
| Smiles |
Cl.FC(F)(F)c1ccc(OC2C3CNCC2C3)nc1
|
Cl.FC(F)(F)c1ccc(OC2C3CNCC2C3)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.